compound A reacts with SOCl 2 to give compound B. B reacts with Mg to form grignard reagant which is treated with acetone and the product is hydrolysed to give 2-Methylbutane-2-ol. find A and B?

Compound A reacts with SOCl2 to give compound B, as B forms grignard reagent, it is alkylhalide which is is formed from alcohol A. B reacts with acetone to give the product calledt-alcohol. So A is an alcohol, B is alkyl halide.CH3CH2OH +SOCl2CH3CH2ClA BCH3CH2Cl + Mg CH3CH2MgClCH3CH2MgCl + CH3COCH3 CH3C(OMgCl)(CH2CH3)CH3CH3C(OH)(CH2CH3)CH3A -EthanolB- Ethyl chloride

  • -1
What are you looking for?