What are CFC(chlorofluorocarbons). What are its harmful effects?

A chlorofluorocarbonis an organic compound typically consisting of chlorine, fluorine, carbon, and hydrogen

CFCs are the responsible for the degradation of the ozone layer in the upper regions of the atmosphere.The ozone layer obsorbs the harmfulultraviolet radiationof the sun.Depletion of the ozone layer leaveslife on earthexposed to the UV rays of the sun.Prolonged exposure to UV rays is known to cause sun burns and skin cancer