The action of HCN followed by hydrolysis and reduction of 1. Acetaldehyde 2. Acetone 3. Benzaldehyde 4. Acetophenone

Dear Student,

As all acetaldehyde, acetone, benzaldehyde, acetophenone belongs to aldehyde and ketone, so they undergo nucleophilic addition reaction on the action of HCN. 
In the case Acetaldehyde: 
(i) CH3CHO HCNCH3CH(OH)-CN(ii) CH3CH(OH)-CNH2O/hydrolysis CH3CH(OH)COOH(iii) CH3CH(OH)-CNReductionCH3CH(OH)CH2NH2

In the case of acetone:
(i) (CH3)2CO HCN(CH3)2C(OH)-CN(ii) (CH3)2C(OH)-CNH2O/hydrolysis (CH3)2C(OH)COOH(iii)(CH3)2C(OH)-CNReduction(CH3)2C(OH)CH2NH2

In the case of benzaldehyde: 
(i) PhCHO HCNPhCH(OH)-CN(ii) PhCH(OH)-CNH2O/hydrolysis PhCH(OH)COOH(iii) PhCH(OH)-CNReductionPhCH(OH)CH2NH2

In the case of acetophenone: 
(i) Ph(CH3)CO HCNPh(CH3)C(OH)-CN(ii) Ph(CH3)C(OH)-CNH2O/hydrolysis Ph(CH3)C(OH)COOH(iii)Ph(CH3)C(OH)-CNReductionPh(CH3)C(OH)CH2NH2

Regards.

  • -1
What are you looking for?